C39H25F3IrN6-2 — CID 153468241
iridium;9-methyl-6-phenyl-1-pyridin-2-yl-2H-carbazol-2-ide;3-phenyl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4,5-tetrazine (PubChem CID 153468241) has the molecular formula C39H25F3IrN6-2 and a molecular weight of 826.88 g/mol. Its IUPAC name is iridium;9-methyl-6-phenyl-1-pyridin-2-yl-2H-carbazol-2-ide;3-phenyl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4,5-tetrazine.
| Compound Name | iridium;9-methyl-6-phenyl-1-pyridin-2-yl-2H-carbazol-2-ide;3-phenyl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 153468241 |
| Molecular Formula | C39H25F3IrN6-2 |
| Molecular Weight | 826.88 g/mol |
| Exact Mass | 827.17 |
| IUPAC Name | iridium;9-methyl-6-phenyl-1-pyridin-2-yl-2H-carbazol-2-ide;3-phenyl-6-[4-(trifluoromethyl)benzene-6-id-1-yl]-1,2,4,5-tetrazine |
| SMILES | Cn1c2ccc(-c3ccccc3)cc2c2cc[c-]c(-c3ccccn3)c21.FC(F)(F)c1c[c-]c(-c2nnc(-c3ccccc3)nn2)cc1.[Ir] |
| InChI | InChI=1S/C24H17N2.C15H8F3N4.Ir/c1-26-23-14-13-18(17-8-3-2-4-9-17)16-21(23)19-10-7-11-20(24(19)26)22-12-5-6-15-25-22;16-15(17,18)12-8-6-11(7-9-12)14-21-19-13(20-22-14)10-4-2-1-3-5-10;/h2-10,12-16H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | GDTPXBGOZYGLRK-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.88 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|