C30H19F3IrN — CID 168823338
iridium(3+);3-phenyl-1-phenylbenzene-6-ide;2-[2-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 168823338) has the molecular formula C30H19F3IrN and a molecular weight of 642.70 g/mol. Its IUPAC name is iridium(3+);3-phenyl-1-phenylbenzene-6-ide;2-[2-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
| Compound Name | iridium(3+);3-phenyl-1-phenylbenzene-6-ide;2-[2-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 168823338 |
| Molecular Formula | C30H19F3IrN |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 643.11 |
| IUPAC Name | iridium(3+);3-phenyl-1-phenylbenzene-6-ide;2-[2-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | FC(F)(F)c1ccc[c-]c1-c1ccccn1.[Ir+3].[c-]1ccccc1-c1[c-]ccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H12.C12H7F3N.Ir/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;13-12(14,15)10-6-2-1-5-9(10)11-7-3-4-8-16-11;/h1-10,12,14H;1-4,6-8H;/q-2;-1;+3 |
| InChIKey | MJRGMHLMDWPZOV-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|