C27H18IrN2O-2 — CID 153446953
6,10-dihydroisochromeno[4,3-b]pyridin-10-ide;iridium;1-phenylisoquinoline (PubChem CID 153446953) has the molecular formula C27H18IrN2O-2 and a molecular weight of 578.67 g/mol. Its IUPAC name is 6,10-dihydroisochromeno[4,3-b]pyridin-10-ide;iridium;1-phenylisoquinoline.
| Compound Name | 6,10-dihydroisochromeno[4,3-b]pyridin-10-ide;iridium;1-phenylisoquinoline |
|---|---|
| PubChem CID | 153446953 |
| Molecular Formula | C27H18IrN2O-2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | 6,10-dihydroisochromeno[4,3-b]pyridin-10-ide;iridium;1-phenylisoquinoline |
| SMILES | [Ir].[c-]1cccc2c1-c1ncccc1OC2.[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C15H10N.C12H8NO.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;1-2-5-10-9(4-1)8-14-11-6-3-7-13-12(10)11;/h1-7,9-11H;1-4,6-7H,8H2;/q2*-1; |
| InChIKey | PWEYSAIMPABJMI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|