C18H10IrNOY-3 — CID 153447007
iridium;8-phenyl-7,10-dihydro-6H-isochromeno[4,3-b]pyridine-7,10-diide;yttrium (PubChem CID 153447007) has the molecular formula C18H10IrNOY-3 and a molecular weight of 537.41 g/mol. Its IUPAC name is iridium;8-phenyl-7,10-dihydro-6H-isochromeno[4,3-b]pyridine-7,10-diide;yttrium.
| Compound Name | iridium;8-phenyl-7,10-dihydro-6H-isochromeno[4,3-b]pyridine-7,10-diide;yttrium |
|---|---|
| PubChem CID | 153447007 |
| Molecular Formula | C18H10IrNOY-3 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.95 |
| IUPAC Name | iridium;8-phenyl-7,10-dihydro-6H-isochromeno[4,3-b]pyridine-7,10-diide;yttrium |
| SMILES | [Ir].[Y].[c-]1ccccc1-c1[c-]c2c([c-]c1)-c1ncccc1OC2 |
| InChI | InChI=1S/C18H10NO.Ir.Y/c1-2-5-13(6-3-1)14-8-9-16-15(11-14)12-20-17-7-4-10-19-18(16)17;;/h1-5,7-8,10H,12H2;;/q-3;; |
| InChIKey | DCMBXQLYMJFICT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|