C35H48IrNO2- — CID 170527619
3-(3,5-dimethylbenzene-6-id-1-yl)-6-ethylisoquinoline;iridium;2,2,5,5-tetraethyl-1,3,3a,4,6,6a-hexahydropentalene-1,6-diol (PubChem CID 170527619) has the molecular formula C35H48IrNO2- and a molecular weight of 706.99 g/mol. Its IUPAC name is 3-(3,5-dimethylbenzene-6-id-1-yl)-6-ethylisoquinoline;iridium;2,2,5,5-tetraethyl-1,3,3a,4,6,6a-hexahydropentalene-1,6-diol.
| Compound Name | 3-(3,5-dimethylbenzene-6-id-1-yl)-6-ethylisoquinoline;iridium;2,2,5,5-tetraethyl-1,3,3a,4,6,6a-hexahydropentalene-1,6-diol |
|---|---|
| PubChem CID | 170527619 |
| Molecular Formula | C35H48IrNO2- |
| Molecular Weight | 706.99 g/mol |
| Exact Mass | 707.33 |
| IUPAC Name | 3-(3,5-dimethylbenzene-6-id-1-yl)-6-ethylisoquinoline;iridium;2,2,5,5-tetraethyl-1,3,3a,4,6,6a-hexahydropentalene-1,6-diol |
| SMILES | CCC1(CC)CC2CC(CC)(CC)C(O)C2C1O.CCc1ccc2cnc(-c3[c-]c(C)cc(C)c3)cc2c1.[Ir] |
| InChI | InChI=1S/C19H18N.C16H30O2.Ir/c1-4-15-5-6-16-12-20-19(11-17(16)10-15)18-8-13(2)7-14(3)9-18;1-5-15(6-2)9-11-10-16(7-3,8-4)14(18)12(11)13(15)17;/h5-8,10-12H,4H2,1-3H3;11-14,17-18H,5-10H2,1-4H3;/q-1;; |
| InChIKey | CTKWFMIMDGUCOV-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.99 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|