C19H19N — CID 170527343
3-(3,5-dimethylphenyl)-6-ethylisoquinoline (PubChem CID 170527343) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-6-ethylisoquinoline.
| Compound Name | 3-(3,5-dimethylphenyl)-6-ethylisoquinoline |
|---|---|
| PubChem CID | 170527343 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-6-ethylisoquinoline |
| SMILES | CCc1ccc2cnc(-c3cc(C)cc(C)c3)cc2c1 |
| InChI | InChI=1S/C19H19N/c1-4-15-5-6-16-12-20-19(11-17(16)10-15)18-8-13(2)7-14(3)9-18/h5-12H,4H2,1-3H3 |
| InChIKey | FFENXKFFVXAPPC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |