C22H21F2N — CID 170221954
6-(3,3-difluorocyclopentyl)-3-(3,5-dimethylphenyl)isoquinoline (PubChem CID 170221954) has the molecular formula C22H21F2N and a molecular weight of 337.41 g/mol. Its IUPAC name is 6-(3,3-difluorocyclopentyl)-3-(3,5-dimethylphenyl)isoquinoline.
| Compound Name | 6-(3,3-difluorocyclopentyl)-3-(3,5-dimethylphenyl)isoquinoline |
|---|---|
| PubChem CID | 170221954 |
| Molecular Formula | C22H21F2N |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 6-(3,3-difluorocyclopentyl)-3-(3,5-dimethylphenyl)isoquinoline |
| SMILES | Cc1cc(C)cc(-c2cc3cc(C4CCC(F)(F)C4)ccc3cn2)c1 |
| InChI | InChI=1S/C22H21F2N/c1-14-7-15(2)9-20(8-14)21-11-19-10-16(3-4-18(19)13-25-21)17-5-6-22(23,24)12-17/h3-4,7-11,13,17H,5-6,12H2,1-2H3 |
| InChIKey | DOBDAMDXSOXKRL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |