C35H37N — CID 166015667
1-(3,5-dimethylphenyl)-8-(3,3,5,5-tetramethylcyclohexyl)naphtho[2,1-f]isoquinoline (PubChem CID 166015667) has the molecular formula C35H37N and a molecular weight of 471.69 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-8-(3,3,5,5-tetramethylcyclohexyl)naphtho[2,1-f]isoquinoline.
| Compound Name | 1-(3,5-dimethylphenyl)-8-(3,3,5,5-tetramethylcyclohexyl)naphtho[2,1-f]isoquinoline |
|---|---|
| PubChem CID | 166015667 |
| Molecular Formula | C35H37N |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-8-(3,3,5,5-tetramethylcyclohexyl)naphtho[2,1-f]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3c2ccc2c4ccc(C5CC(C)(C)CC(C)(C)C5)cc4ccc32)c1 |
| InChI | InChI=1S/C35H37N/c1-22-15-23(2)17-26(16-22)33-32-12-11-29-28-9-7-24(27-19-34(3,4)21-35(5,6)20-27)18-25(28)8-10-30(29)31(32)13-14-36-33/h7-18,27H,19-21H2,1-6H3 |
| InChIKey | JENZZXCEAAZISL-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|