C42H59N — CID 172542903
1-(3,5-dimethylphenyl)-6-[tris(4,4-dimethylcyclohexyl)methyl]isoquinoline (PubChem CID 172542903) has the molecular formula C42H59N and a molecular weight of 577.94 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-6-[tris(4,4-dimethylcyclohexyl)methyl]isoquinoline.
| Compound Name | 1-(3,5-dimethylphenyl)-6-[tris(4,4-dimethylcyclohexyl)methyl]isoquinoline |
|---|---|
| PubChem CID | 172542903 |
| Molecular Formula | C42H59N |
| Molecular Weight | 577.94 g/mol |
| Exact Mass | 577.46 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-6-[tris(4,4-dimethylcyclohexyl)methyl]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2nccc3cc(C(C4CCC(C)(C)CC4)(C4CCC(C)(C)CC4)C4CCC(C)(C)CC4)ccc23)c1 |
| InChI | InChI=1S/C42H59N/c1-29-25-30(2)27-32(26-29)38-37-10-9-36(28-31(37)17-24-43-38)42(33-11-18-39(3,4)19-12-33,34-13-20-40(5,6)21-14-34)35-15-22-41(7,8)23-16-35/h9-10,17,24-28,33-35H,11-16,18-23H2,1-8H3 |
| InChIKey | XGUQLCRSCCOXJB-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.94 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |