C47H48IrNO2- — CID 164727800
(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;2-phenyl-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)quinoline (PubChem CID 164727800) has the molecular formula C47H48IrNO2- and a molecular weight of 851.12 g/mol. Its IUPAC name is (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;2-phenyl-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)quinoline.
| Compound Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;2-phenyl-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)quinoline |
|---|---|
| PubChem CID | 164727800 |
| Molecular Formula | C47H48IrNO2- |
| Molecular Weight | 851.12 g/mol |
| Exact Mass | 851.33 |
| IUPAC Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;2-phenyl-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)quinoline |
| SMILES | O=C(/C=C(\O)C1CCCCC1)C1CCCCC1.[Ir].[c-]1ccccc1-c1cc(-c2ccc3c(c2)CC2(Cc4ccccc4C2)C3)c2ccccc2n1 |
| InChI | InChI=1S/C32H24N.C15H24O2.Ir/c1-2-8-22(9-3-1)31-17-29(28-12-6-7-13-30(28)33-31)23-14-15-26-20-32(21-27(26)16-23)18-24-10-4-5-11-25(24)19-32;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h1-8,10-17H,18-21H2;11-13,16H,1-10H2;/q-1;;/b;14-11-; |
| InChIKey | UVNVGUDYYURARR-CKWHXWLXSA-N |
| XLogP | 11.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.12 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|