C37H45IrN2O2- — CID 171590683
(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;5,5,10,10-tetramethyl-9-pyridin-2-yl-8H-benzo[g]quinolin-8-ide (PubChem CID 171590683) has the molecular formula C37H45IrN2O2- and a molecular weight of 742.00 g/mol. Its IUPAC name is (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;5,5,10,10-tetramethyl-9-pyridin-2-yl-8H-benzo[g]quinolin-8-ide.
| Compound Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;5,5,10,10-tetramethyl-9-pyridin-2-yl-8H-benzo[g]quinolin-8-ide |
|---|---|
| PubChem CID | 171590683 |
| Molecular Formula | C37H45IrN2O2- |
| Molecular Weight | 742.00 g/mol |
| Exact Mass | 742.31 |
| IUPAC Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;iridium;5,5,10,10-tetramethyl-9-pyridin-2-yl-8H-benzo[g]quinolin-8-ide |
| SMILES | CC1(C)c2cccnc2C(C)(C)c2c(-c3ccccn3)[c-]ccc21.O=C(/C=C(\O)C1CCCCC1)C1CCCCC1.[Ir] |
| InChI | InChI=1S/C22H21N2.C15H24O2.Ir/c1-21(2)16-10-7-9-15(18-12-5-6-13-23-18)19(16)22(3,4)20-17(21)11-8-14-24-20;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h5-8,10-14H,1-4H3;11-13,16H,1-10H2;/q-1;;/b;14-11-; |
| InChIKey | RQERFRHCPDVVHY-CKWHXWLXSA-N |
| XLogP | 9.06 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.00 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|