C15H24O2Zr — CID 171762262
(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;zirconium (PubChem CID 171762262) has the molecular formula C15H24O2Zr and a molecular weight of 327.58 g/mol. Its IUPAC name is (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;zirconium.
| Compound Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;zirconium |
|---|---|
| PubChem CID | 171762262 |
| Molecular Formula | C15H24O2Zr |
| Molecular Weight | 327.58 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;zirconium |
| SMILES | O=C(/C=C(\O)C1CCCCC1)C1CCCCC1.[Zr] |
| InChI | InChI=1S/C15H24O2.Zr/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h11-13,16H,1-10H2;/b14-11-; |
| InChIKey | WDFGURKUXGYUON-IRIIKGHASA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|