About (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium
(Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium (PubChem CID 171762223) has the molecular formula C14H24O2Zr
and a molecular weight of 315.57 g/mol. Its IUPAC name is (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium.
Molecular Properties
| Compound Name | (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium |
| PubChem CID | 171762223 |
| Molecular Formula | C14H24O2Zr |
| Molecular Weight | 315.57 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium |
| SMILES | CCCCC/C(O)=C/C(=O)C1CCCCC1.[Zr] |
| InChI | InChI=1S/C14H24O2.Zr/c1-2-3-5-10-13(15)11-14(16)12-8-6-4-7-9-12;/h11-12,15H,2-10H2,1H3;/b13-11-; |
| InChIKey | ILLVJGKMRHHYME-KEHAOADBSA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium?
The IUPAC name of (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium (CID 171762223) is (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium.
What is the SMILES notation for (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium?
The canonical SMILES for (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium is CCCCC/C(O)=C/C(=O)C1CCCCC1.[Zr].
What is the InChIKey of (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium?
The InChIKey is ILLVJGKMRHHYME-KEHAOADBSA-N. The full InChI is InChI=1S/C14H24O2.Zr/c1-2-3-5-10-13(15)11-14(16)12-8-6-4-7-9-12;/h11-12,15H,2-10H2,1H3;/b13-11-;.
What are the key properties of (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium?
(Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium has a molecular weight of 315.57 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyclohexyl-3-hydroxyoct-2-en-1-one;zirconium is sourced from PubChem (CID 171762223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).