C21H35NO — CID 68500150
(E)-1,3-dicyclohexyl-3-(cyclohexylamino)prop-2-en-1-one (PubChem CID 68500150) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (E)-1,3-dicyclohexyl-3-(cyclohexylamino)prop-2-en-1-one.
| Compound Name | (E)-1,3-dicyclohexyl-3-(cyclohexylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 68500150 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (E)-1,3-dicyclohexyl-3-(cyclohexylamino)prop-2-en-1-one |
| SMILES | O=C(/C=C(/NC1CCCCC1)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H35NO/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22-19-14-8-3-9-15-19/h16-19,22H,1-15H2/b20-16+ |
| InChIKey | DNDFBGOPZVHADE-CAPFRKAQSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|