C42H42IrNO3- — CID 167354504
(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;2,3-dimethyl-6-(2H-naphthalen-2-id-1-yl)-[1]benzofuro[2,3-c]quinoline;iridium (PubChem CID 167354504) has the molecular formula C42H42IrNO3- and a molecular weight of 801.02 g/mol. Its IUPAC name is (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;2,3-dimethyl-6-(2H-naphthalen-2-id-1-yl)-[1]benzofuro[2,3-c]quinoline;iridium.
| Compound Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;2,3-dimethyl-6-(2H-naphthalen-2-id-1-yl)-[1]benzofuro[2,3-c]quinoline;iridium |
|---|---|
| PubChem CID | 167354504 |
| Molecular Formula | C42H42IrNO3- |
| Molecular Weight | 801.02 g/mol |
| Exact Mass | 801.28 |
| IUPAC Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;2,3-dimethyl-6-(2H-naphthalen-2-id-1-yl)-[1]benzofuro[2,3-c]quinoline;iridium |
| SMILES | Cc1cc2nc(-c3[c-]ccc4ccccc34)c3oc4ccccc4c3c2cc1C.O=C(/C=C(\O)C1CCCCC1)C1CCCCC1.[Ir] |
| InChI | InChI=1S/C27H18NO.C15H24O2.Ir/c1-16-14-22-23(15-17(16)2)28-26(20-12-7-9-18-8-3-4-10-19(18)20)27-25(22)21-11-5-6-13-24(21)29-27;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h3-11,13-15H,1-2H3;11-13,16H,1-10H2;/q-1;;/b;14-11-; |
| InChIKey | QMMNBYPWFAAFRC-CKWHXWLXSA-N |
| XLogP | 11.53 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.02 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|