C33H29IrN2O2- — CID 167354918
(Z)-4-hydroxypent-3-en-2-one;iridium;2,3,7-trimethyl-6-(2H-naphthalen-2-id-1-yl)indolo[2,3-c]quinoline (PubChem CID 167354918) has the molecular formula C33H29IrN2O2- and a molecular weight of 677.82 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2,3,7-trimethyl-6-(2H-naphthalen-2-id-1-yl)indolo[2,3-c]quinoline.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2,3,7-trimethyl-6-(2H-naphthalen-2-id-1-yl)indolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 167354918 |
| Molecular Formula | C33H29IrN2O2- |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2,3,7-trimethyl-6-(2H-naphthalen-2-id-1-yl)indolo[2,3-c]quinoline |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc2nc(-c3[c-]ccc4ccccc34)c3c(c2cc1C)c1ccccc1n3C.[Ir] |
| InChI | InChI=1S/C28H21N2.C5H8O2.Ir/c1-17-15-23-24(16-18(17)2)29-27(21-13-8-10-19-9-4-5-11-20(19)21)28-26(23)22-12-6-7-14-25(22)30(28)3;1-4(6)3-5(2)7;/h4-12,14-16H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | NOMFTSJVKISOJM-LWFKIUJUSA-N |
| XLogP | 8.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|