C48H43IrN2O3- — CID 172504518
(Z)-4-hydroxypent-3-en-2-one;iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole (PubChem CID 172504518) has the molecular formula C48H43IrN2O3- and a molecular weight of 888.10 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 172504518 |
| Molecular Formula | C48H43IrN2O3- |
| Molecular Weight | 888.10 g/mol |
| Exact Mass | 888.29 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole |
| SMILES | CC(=O)/C=C(/C)O.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc(-c4ccccc4)ccc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C43H35N2O.C5H8O2.Ir/c1-27(2)36-24-32(30-16-9-6-10-17-30)25-37(28(3)4)41(36)45-39-21-12-11-20-38(39)44-43(45)35-19-13-18-34-33-23-22-31(26-40(33)46-42(34)35)29-14-7-5-8-15-29;1-4(6)3-5(2)7;/h5-18,20-28H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | UYFXWIJJPTYPQT-LWFKIUJUSA-N |
| XLogP | 13.01 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.10 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|