C37H30FIrN2O- — CID 170931355
2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;iridium (PubChem CID 170931355) has the molecular formula C37H30FIrN2O- and a molecular weight of 729.88 g/mol. Its IUPAC name is 2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;iridium.
| Compound Name | 2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;iridium |
|---|---|
| PubChem CID | 170931355 |
| Molecular Formula | C37H30FIrN2O- |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 730.20 |
| IUPAC Name | 2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;iridium |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc(F)ccc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C37H30FN2O.Ir/c1-22(2)30-19-25(24-11-6-5-7-12-24)20-31(23(3)4)35(30)40-33-16-9-8-15-32(33)39-37(40)29-14-10-13-28-27-18-17-26(38)21-34(27)41-36(28)29;/h5-13,15-23H,1-4H3;/q-1; |
| InChIKey | AURMVCXGDHQWGC-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|