C40H42IrNO3- — CID 168847191
6-(1-deuteriocyclopentyl)-1-[2-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;(Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;iridium (PubChem CID 168847191) has the molecular formula C40H42IrNO3- and a molecular weight of 781.02 g/mol. Its IUPAC name is 6-(1-deuteriocyclopentyl)-1-[2-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;(Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;iridium.
| Compound Name | 6-(1-deuteriocyclopentyl)-1-[2-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;(Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;iridium |
|---|---|
| PubChem CID | 168847191 |
| Molecular Formula | C40H42IrNO3- |
| Molecular Weight | 781.02 g/mol |
| Exact Mass | 781.31 |
| IUPAC Name | 6-(1-deuteriocyclopentyl)-1-[2-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]isoquinoline;(Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;iridium |
| SMILES | O=C(/C=C(\O)C1CCCC1)C1CCCC1.[2H]C([2H])([2H])c1[c-]c(-c2nccc3cc(C4([2H])CCCC4)ccc23)c2oc3ccccc3c2c1.[Ir] |
| InChI | InChI=1S/C27H22NO.C13H20O2.Ir/c1-17-14-23-22-8-4-5-9-25(22)29-27(23)24(15-17)26-21-11-10-19(18-6-2-3-7-18)16-20(21)12-13-28-26;14-12(10-5-1-2-6-10)9-13(15)11-7-3-4-8-11;/h4-5,8-14,16,18H,2-3,6-7H2,1H3;9-11,14H,1-8H2;/q-1;;/b;12-9-;/i1D3,18D;; |
| InChIKey | VJPRAMWDXMCPME-WRPYAJFPSA-N |
| XLogP | 10.94 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.02 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|