C41H46IrNO3- — CID 167337828
6-cyclopentyl-4-cyclopropyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium (PubChem CID 167337828) has the molecular formula C41H46IrNO3- and a molecular weight of 793.04 g/mol. Its IUPAC name is 6-cyclopentyl-4-cyclopropyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium.
| Compound Name | 6-cyclopentyl-4-cyclopropyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 167337828 |
| Molecular Formula | C41H46IrNO3- |
| Molecular Weight | 793.04 g/mol |
| Exact Mass | 793.31 |
| IUPAC Name | 6-cyclopentyl-4-cyclopropyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;(Z)-6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium |
| SMILES | CC(C)CC(=O)/C=C(\O)CC(C)C.Cc1[c-]c(-c2ncc(C3CC3)c3cc(C4CCCC4)ccc23)c2oc3ccccc3c2c1.[Ir] |
| InChI | InChI=1S/C30H26NO.C11H20O2.Ir/c1-18-14-25-22-8-4-5-9-28(22)32-30(25)26(15-18)29-23-13-12-21(19-6-2-3-7-19)16-24(23)27(17-31-29)20-10-11-20;1-8(2)5-10(12)7-11(13)6-9(3)4;/h4-5,8-9,12-14,16-17,19-20H,2-3,6-7,10-11H2,1H3;7-9,12H,5-6H2,1-4H3;/q-1;;/b;10-7-; |
| InChIKey | FSMQNKLXFKLORU-YAJOTRLJSA-N |
| XLogP | 11.53 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.04 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|