C40H40IrNO3- — CID 156677654
1-cyclopentyl-4-methanidyl-3-[2-(2-methylpropyl)-3H-dibenzofuran-3-id-4-yl]benzo[f]quinolin-4-ium;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 156677654) has the molecular formula C40H40IrNO3- and a molecular weight of 774.98 g/mol. Its IUPAC name is 1-cyclopentyl-4-methanidyl-3-[2-(2-methylpropyl)-3H-dibenzofuran-3-id-4-yl]benzo[f]quinolin-4-ium;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 1-cyclopentyl-4-methanidyl-3-[2-(2-methylpropyl)-3H-dibenzofuran-3-id-4-yl]benzo[f]quinolin-4-ium;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 156677654 |
| Molecular Formula | C40H40IrNO3- |
| Molecular Weight | 774.98 g/mol |
| Exact Mass | 775.26 |
| IUPAC Name | 1-cyclopentyl-4-methanidyl-3-[2-(2-methylpropyl)-3H-dibenzofuran-3-id-4-yl]benzo[f]quinolin-4-ium;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[CH2-][n+]1c(-c2[c-]c(CC(C)C)cc3c2oc2ccccc23)cc(C2CCCC2)c2c3ccccc3ccc21.[Ir] |
| InChI | InChI=1S/C35H32NO.C5H8O2.Ir/c1-22(2)18-23-19-29-27-14-8-9-15-33(27)37-35(29)30(20-23)32-21-28(24-10-4-5-11-24)34-26-13-7-6-12-25(26)16-17-31(34)36(32)3;1-4(6)3-5(2)7;/h6-9,12-17,19,21-22,24H,3-5,10-11,18H2,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | GKUOLKDJSXCDBF-LWFKIUJUSA-N |
| XLogP | 10.18 |
| TPSA | 54.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.98 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|