C45H50IrNO2S- — CID 156677740
1-cyclopentyl-4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)benzo[f]quinolin-4-ium;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 156677740) has the molecular formula C45H50IrNO2S- and a molecular weight of 861.18 g/mol. Its IUPAC name is 1-cyclopentyl-4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)benzo[f]quinolin-4-ium;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 1-cyclopentyl-4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)benzo[f]quinolin-4-ium;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 156677740 |
| Molecular Formula | C45H50IrNO2S- |
| Molecular Weight | 861.18 g/mol |
| Exact Mass | 861.32 |
| IUPAC Name | 1-cyclopentyl-4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)benzo[f]quinolin-4-ium;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[CH2-][n+]1c(-c2[c-]c(C)cc3c2sc2ccccc23)cc(C2CCCC2)c2c3ccccc3ccc21.[Ir] |
| InChI | InChI=1S/C32H26NS.C13H24O2.Ir/c1-20-17-26-24-13-7-8-14-30(24)34-32(26)27(18-20)29-19-25(21-9-3-4-10-21)31-23-12-6-5-11-22(23)15-16-28(31)33(29)2;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-8,11-17,19,21H,2-4,9-10H2,1H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | QOPKMEALOYHFMN-DZTQYQPZSA-N |
| XLogP | 12.59 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.18 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|