C43H56IrNO2- — CID 171746669
4-cyclohexyl-2-(5,7-dimethyl-4-propan-2-yl-1H-naphthalen-1-id-2-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 171746669) has the molecular formula C43H56IrNO2- and a molecular weight of 811.14 g/mol. Its IUPAC name is 4-cyclohexyl-2-(5,7-dimethyl-4-propan-2-yl-1H-naphthalen-1-id-2-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 4-cyclohexyl-2-(5,7-dimethyl-4-propan-2-yl-1H-naphthalen-1-id-2-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 171746669 |
| Molecular Formula | C43H56IrNO2- |
| Molecular Weight | 811.14 g/mol |
| Exact Mass | 811.39 |
| IUPAC Name | 4-cyclohexyl-2-(5,7-dimethyl-4-propan-2-yl-1H-naphthalen-1-id-2-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c2c(C(C)C)cc(-c3cc(C4CCCCC4)c4ccccc4n3)[c-]c2c1.[Ir] |
| InChI | InChI=1S/C30H32N.C13H24O2.Ir/c1-19(2)26-17-23(16-24-15-20(3)14-21(4)30(24)26)29-18-27(22-10-6-5-7-11-22)25-12-8-9-13-28(25)31-29;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-9,12-15,17-19,22H,5-7,10-11H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | DRUCTLBNPSARKW-DZTQYQPZSA-N |
| XLogP | 12.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.14 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|