C43H58IrNO2Si- — CID 170932188
[3-(4-cyclopentyl-5,7-dimethylquinolin-2-yl)-4H-naphthalen-4-id-1-yl]methyl-trimethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 170932188) has the molecular formula C43H58IrNO2Si- and a molecular weight of 841.24 g/mol. Its IUPAC name is [3-(4-cyclopentyl-5,7-dimethylquinolin-2-yl)-4H-naphthalen-4-id-1-yl]methyl-trimethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | [3-(4-cyclopentyl-5,7-dimethylquinolin-2-yl)-4H-naphthalen-4-id-1-yl]methyl-trimethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 170932188 |
| Molecular Formula | C43H58IrNO2Si- |
| Molecular Weight | 841.24 g/mol |
| Exact Mass | 841.39 |
| IUPAC Name | [3-(4-cyclopentyl-5,7-dimethylquinolin-2-yl)-4H-naphthalen-4-id-1-yl]methyl-trimethylsilane;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(C)c2c(C3CCCC3)cc(-c3[c-]c4ccccc4c(C[Si](C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C30H34NSi.C13H24O2.Ir/c1-20-14-21(2)30-27(22-10-6-7-11-22)18-28(31-29(30)15-20)24-16-23-12-8-9-13-26(23)25(17-24)19-32(3,4)5;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h8-9,12-15,17-18,22H,6-7,10-11,19H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | MHZMICLWIXIMKG-DZTQYQPZSA-N |
| XLogP | 12.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.24 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|