C45H55F3IrNO2- — CID 154599491
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one (PubChem CID 154599491) has the molecular formula C45H55F3IrNO2- and a molecular weight of 891.15 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 154599491 |
| Molecular Formula | C45H55F3IrNO2- |
| Molecular Weight | 891.15 g/mol |
| Exact Mass | 891.38 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;iridium;(Z)-6,6,6-trifluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(F)(F)F.Cc1cc(C)c2c(C3CCC(C4CCCCC4)CC3)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C37H44N.C8H11F3O2.Ir/c1-24-19-25(2)36-32(28-17-15-27(16-18-28)26-11-7-6-8-12-26)23-34(38-35(36)20-24)30-21-29-13-9-10-14-31(29)33(22-30)37(3,4)5;1-7(2,3)5(12)4-6(13)8(9,10)11;/h9-10,13-14,19-20,22-23,26-28H,6-8,11-12,15-18H2,1-5H3;4,13H,1-3H3;/q-1;;/b;6-4-; |
| InChIKey | AWTYZURNZUWUNT-GONQOWGMSA-N |
| XLogP | 13.23 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.15 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|