C45H62IrNO2- — CID 166026587
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4,5,7-trimethylquinoline;(Z)-7-hydroxy-2,2,4,4,8,8,10,10-octamethylundec-6-en-5-one;iridium (PubChem CID 166026587) has the molecular formula C45H62IrNO2- and a molecular weight of 841.21 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4,5,7-trimethylquinoline;(Z)-7-hydroxy-2,2,4,4,8,8,10,10-octamethylundec-6-en-5-one;iridium.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4,5,7-trimethylquinoline;(Z)-7-hydroxy-2,2,4,4,8,8,10,10-octamethylundec-6-en-5-one;iridium |
|---|---|
| PubChem CID | 166026587 |
| Molecular Formula | C45H62IrNO2- |
| Molecular Weight | 841.21 g/mol |
| Exact Mass | 841.44 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4,5,7-trimethylquinoline;(Z)-7-hydroxy-2,2,4,4,8,8,10,10-octamethylundec-6-en-5-one;iridium |
| SMILES | CC(C)(C)CC(C)(C)C(=O)/C=C(\O)C(C)(C)CC(C)(C)C.Cc1cc(C)c2c(C)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C26H26N.C19H36O2.Ir/c1-16-11-17(2)25-18(3)13-23(27-24(25)12-16)20-14-19-9-7-8-10-21(19)22(15-20)26(4,5)6;1-16(2,3)12-18(7,8)14(20)11-15(21)19(9,10)13-17(4,5)6;/h7-13,15H,1-6H3;11,20H,12-13H2,1-10H3;/q-1;;/b;14-11-; |
| InChIKey | SISMLWGNNZEYNN-CKWHXWLXSA-N |
| XLogP | 13.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.21 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|