C48H64IrNO2- — CID 154599443
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 154599443) has the molecular formula C48H64IrNO2- and a molecular weight of 879.26 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154599443 |
| Molecular Formula | C48H64IrNO2- |
| Molecular Weight | 879.26 g/mol |
| Exact Mass | 879.46 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(4-cyclohexylcyclohexyl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc(C)c2c(C3CCC(C4CCCCC4)CC3)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C37H44N.C11H20O2.Ir/c1-24-19-25(2)36-32(28-17-15-27(16-18-28)26-11-7-6-8-12-26)23-34(38-35(36)20-24)30-21-29-13-9-10-14-31(29)33(22-30)37(3,4)5;1-10(2,3)8(12)7-9(13)11(4,5)6;/h9-10,13-14,19-20,22-23,26-28H,6-8,11-12,15-18H2,1-5H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | WLDJRFHGVZCGRG-HXIBTQJOSA-N |
| XLogP | 13.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.26 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|