C47H62IrNO2- — CID 154599429
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(3,3-dimethylspiro[5.5]undecan-9-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium (PubChem CID 154599429) has the molecular formula C47H62IrNO2- and a molecular weight of 865.24 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(3,3-dimethylspiro[5.5]undecan-9-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(3,3-dimethylspiro[5.5]undecan-9-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154599429 |
| Molecular Formula | C47H62IrNO2- |
| Molecular Weight | 865.24 g/mol |
| Exact Mass | 865.44 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-4-(3,3-dimethylspiro[5.5]undecan-9-yl)-5,7-dimethylquinoline;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.Cc1cc(C)c2c(C3CCC4(CC3)CCC(C)(C)CC4)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.[Ir] |
| InChI | InChI=1S/C38H46N.C9H16O2.Ir/c1-25-20-26(2)35-31(27-12-14-38(15-13-27)18-16-37(6,7)17-19-38)24-33(39-34(35)21-25)29-22-28-10-8-9-11-30(28)32(23-29)36(3,4)5;1-6(2)8(10)5-9(11)7(3)4;/h8-11,20-21,23-24,27H,12-19H2,1-7H3;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | OTFIAJFILNTILR-QBBOVCHSSA-N |
| XLogP | 13.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.24 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|