C38H30IrNO2S- — CID 156677742
(Z)-4-hydroxypent-3-en-2-one;iridium;4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)-1-phenylbenzo[f]quinolin-4-ium (PubChem CID 156677742) has the molecular formula C38H30IrNO2S- and a molecular weight of 756.95 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)-1-phenylbenzo[f]quinolin-4-ium.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)-1-phenylbenzo[f]quinolin-4-ium |
|---|---|
| PubChem CID | 156677742 |
| Molecular Formula | C38H30IrNO2S- |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 757.16 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-methanidyl-3-(2-methyl-3H-dibenzothiophen-3-id-4-yl)-1-phenylbenzo[f]quinolin-4-ium |
| SMILES | CC(=O)/C=C(/C)O.[CH2-][n+]1c(-c2[c-]c(C)cc3c2sc2ccccc23)cc(-c2ccccc2)c2c3ccccc3ccc21.[Ir] |
| InChI | InChI=1S/C33H22NS.C5H8O2.Ir/c1-21-18-27-25-14-8-9-15-31(25)35-33(27)28(19-21)30-20-26(22-10-4-3-5-11-22)32-24-13-7-6-12-23(24)16-17-29(32)34(30)2;1-4(6)3-5(2)7;/h3-18,20H,2H2,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | DJMPHCLHHVIRSY-LWFKIUJUSA-N |
| XLogP | 9.77 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|