C34H30IrNO2S- — CID 171460295
(Z)-4-hydroxypent-3-en-2-one;iridium;8-methyl-1-(4-propan-2-yl-1H-phenanthren-1-id-2-yl)-[1]benzothiolo[2,3-c]pyridine (PubChem CID 171460295) has the molecular formula C34H30IrNO2S- and a molecular weight of 708.90 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;8-methyl-1-(4-propan-2-yl-1H-phenanthren-1-id-2-yl)-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;8-methyl-1-(4-propan-2-yl-1H-phenanthren-1-id-2-yl)-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 171460295 |
| Molecular Formula | C34H30IrNO2S- |
| Molecular Weight | 708.90 g/mol |
| Exact Mass | 709.16 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;8-methyl-1-(4-propan-2-yl-1H-phenanthren-1-id-2-yl)-[1]benzothiolo[2,3-c]pyridine |
| SMILES | CC(=O)/C=C(/C)O.Cc1cccc2c1sc1c(-c3[c-]c4ccc5ccccc5c4c(C(C)C)c3)nccc12.[Ir] |
| InChI | InChI=1S/C29H22NS.C5H8O2.Ir/c1-17(2)25-16-21(15-20-12-11-19-8-4-5-9-22(19)26(20)25)27-29-24(13-14-30-27)23-10-6-7-18(3)28(23)31-29;1-4(6)3-5(2)7;/h4-14,16-17H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | DXXYHIVHUDKYIC-LWFKIUJUSA-N |
| XLogP | 9.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.90 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|