C33H37GeIrN2O2S- — CID 166018676
(Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[6-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]germane (PubChem CID 166018676) has the molecular formula C33H37GeIrN2O2S- and a molecular weight of 790.56 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[6-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]germane.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[6-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]germane |
|---|---|
| PubChem CID | 166018676 |
| Molecular Formula | C33H37GeIrN2O2S- |
| Molecular Weight | 790.56 g/mol |
| Exact Mass | 792.14 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;trimethyl-[6-(4-pentan-3-yl-1H-naphthalen-1-id-2-yl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]germane |
| SMILES | CC(=O)/C=C(/C)O.CCC(CC)c1cc(-c2nccc3c2sc2nc([Ge](C)(C)C)ccc23)[c-]c2ccccc12.[Ir] |
| InChI | InChI=1S/C28H29GeN2S.C5H8O2.Ir/c1-6-18(7-2)24-17-20(16-19-10-8-9-11-21(19)24)26-27-22(14-15-30-26)23-12-13-25(29(3,4)5)31-28(23)32-27;1-4(6)3-5(2)7;/h8-15,17-18H,6-7H2,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | ONQUSHIJJOJYCG-LWFKIUJUSA-N |
| XLogP | 8.95 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.56 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|