C35H30IrNO3- — CID 167337850
6-cyclopentyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;1-(2-hydroxyphenyl)ethanone;iridium (PubChem CID 167337850) has the molecular formula C35H30IrNO3- and a molecular weight of 704.85 g/mol. Its IUPAC name is 6-cyclopentyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;1-(2-hydroxyphenyl)ethanone;iridium.
| Compound Name | 6-cyclopentyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;1-(2-hydroxyphenyl)ethanone;iridium |
|---|---|
| PubChem CID | 167337850 |
| Molecular Formula | C35H30IrNO3- |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 705.19 |
| IUPAC Name | 6-cyclopentyl-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;1-(2-hydroxyphenyl)ethanone;iridium |
| SMILES | CC(=O)c1ccccc1O.Cc1[c-]c(-c2nccc3cc(C4CCCC4)ccc23)c2oc3ccccc3c2c1.[Ir] |
| InChI | InChI=1S/C27H22NO.C8H8O2.Ir/c1-17-14-23-22-8-4-5-9-25(22)29-27(23)24(15-17)26-21-11-10-19(18-6-2-3-7-18)16-20(21)12-13-28-26;1-6(9)7-4-2-3-5-8(7)10;/h4-5,8-14,16,18H,2-3,6-7H2,1H3;2-5,10H,1H3;/q-1;; |
| InChIKey | GEZQLSUQPUTCRU-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|