C43H38IrN2O-2 — CID 167337854
iridium;1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-6-spiro[4.5]decan-8-ylisoquinoline;2-phenylpyridine (PubChem CID 167337854) has the molecular formula C43H38IrN2O-2 and a molecular weight of 791.01 g/mol. Its IUPAC name is iridium;1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-6-spiro[4.5]decan-8-ylisoquinoline;2-phenylpyridine.
| Compound Name | iridium;1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-6-spiro[4.5]decan-8-ylisoquinoline;2-phenylpyridine |
|---|---|
| PubChem CID | 167337854 |
| Molecular Formula | C43H38IrN2O-2 |
| Molecular Weight | 791.01 g/mol |
| Exact Mass | 791.26 |
| IUPAC Name | iridium;1-(2-methyl-3H-dibenzofuran-3-id-4-yl)-6-spiro[4.5]decan-8-ylisoquinoline;2-phenylpyridine |
| SMILES | Cc1[c-]c(-c2nccc3cc(C4CCC5(CCCC5)CC4)ccc23)c2oc3ccccc3c2c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C32H30NO.C11H8N.Ir/c1-21-18-27-26-6-2-3-7-29(26)34-31(27)28(19-21)30-25-9-8-23(20-24(25)12-17-33-30)22-10-15-32(16-11-22)13-4-5-14-32;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-3,6-9,12,17-18,20,22H,4-5,10-11,13-16H2,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | HYSJUSPXNLWKQL-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.01 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|