C42H46IrNO3- — CID 168847173
(Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;6-(3,3-dimethylcyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium (PubChem CID 168847173) has the molecular formula C42H46IrNO3- and a molecular weight of 805.05 g/mol. Its IUPAC name is (Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;6-(3,3-dimethylcyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium.
| Compound Name | (Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;6-(3,3-dimethylcyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium |
|---|---|
| PubChem CID | 168847173 |
| Molecular Formula | C42H46IrNO3- |
| Molecular Weight | 805.05 g/mol |
| Exact Mass | 805.31 |
| IUPAC Name | (Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;6-(3,3-dimethylcyclopentyl)-1-(2-methyl-3H-dibenzofuran-3-id-4-yl)isoquinoline;iridium |
| SMILES | Cc1[c-]c(-c2nccc3cc(C4CCC(C)(C)C4)ccc23)c2oc3ccccc3c2c1.O=C(/C=C(\O)C1CCCC1)C1CCCC1.[Ir] |
| InChI | InChI=1S/C29H26NO.C13H20O2.Ir/c1-18-14-24-23-6-4-5-7-26(23)31-28(24)25(15-18)27-22-9-8-19(16-20(22)11-13-30-27)21-10-12-29(2,3)17-21;14-12(10-5-1-2-6-10)9-13(15)11-7-3-4-8-11;/h4-9,11,13-14,16,21H,10,12,17H2,1-3H3;9-11,14H,1-8H2;/q-1;;/b;12-9-; |
| InChIKey | HFRIMUDKXIWMGL-DZTQYQPZSA-N |
| XLogP | 11.58 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.05 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|