C35H40IrN3O3- — CID 149496290
2,6-dimethyl-8-(7-propan-2-ylquinazolin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium (PubChem CID 149496290) has the molecular formula C35H40IrN3O3- and a molecular weight of 742.94 g/mol. Its IUPAC name is 2,6-dimethyl-8-(7-propan-2-ylquinazolin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium.
| Compound Name | 2,6-dimethyl-8-(7-propan-2-ylquinazolin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 149496290 |
| Molecular Formula | C35H40IrN3O3- |
| Molecular Weight | 742.94 g/mol |
| Exact Mass | 743.27 |
| IUPAC Name | 2,6-dimethyl-8-(7-propan-2-ylquinazolin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;6-hydroxy-2,8-dimethylnon-5-en-4-one;iridium |
| SMILES | CC(C)CC(=O)C=C(O)CC(C)C.Cc1[c-]c(-c2ncnc3cc(C(C)C)ccc23)c2oc3nc(C)ccc3c2c1.[Ir] |
| InChI | InChI=1S/C24H20N3O.C11H20O2.Ir/c1-13(2)16-6-8-18-21(11-16)25-12-26-22(18)20-10-14(3)9-19-17-7-5-15(4)27-24(17)28-23(19)20;1-8(2)5-10(12)7-11(13)6-9(3)4;/h5-9,11-13H,1-4H3;7-9,12H,5-6H2,1-4H3;/q-1;; |
| InChIKey | ANHUDXBTZUBBPG-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.94 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|