C39H45IrN2O3- — CID 169033750
(Z)-6-hydroxy-2,2,8,8-tetramethylnon-5-en-4-one;iridium;8-[5-(3-propan-2-ylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 169033750) has the molecular formula C39H45IrN2O3- and a molecular weight of 785.04 g/mol. Its IUPAC name is (Z)-6-hydroxy-2,2,8,8-tetramethylnon-5-en-4-one;iridium;8-[5-(3-propan-2-ylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | (Z)-6-hydroxy-2,2,8,8-tetramethylnon-5-en-4-one;iridium;8-[5-(3-propan-2-ylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 169033750 |
| Molecular Formula | C39H45IrN2O3- |
| Molecular Weight | 785.04 g/mol |
| Exact Mass | 785.33 |
| IUPAC Name | (Z)-6-hydroxy-2,2,8,8-tetramethylnon-5-en-4-one;iridium;8-[5-(3-propan-2-ylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | CC(C)(C)CC(=O)/C=C(\O)CC(C)(C)C.[2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccc(-c4cccc(C(C)C)c4)cn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C26H21N2O.C13H24O2.Ir/c1-16(2)18-6-4-7-19(14-18)20-11-13-24(27-15-20)23-9-5-8-21-22-12-10-17(3)28-26(22)29-25(21)23;1-12(2,3)8-10(14)7-11(15)9-13(4,5)6;/h4-8,10-16H,1-3H3;7,14H,8-9H2,1-6H3;/q-1;;/b;10-7-;/i3D3;; |
| InChIKey | AAHVNDDEZYPXIQ-FPSUXJLPSA-N |
| XLogP | 10.81 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.04 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|