C40H47IrN2O3- — CID 169033767
8-[5-(3-tert-butylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium (PubChem CID 169033767) has the molecular formula C40H47IrN2O3- and a molecular weight of 799.06 g/mol. Its IUPAC name is 8-[5-(3-tert-butylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium.
| Compound Name | 8-[5-(3-tert-butylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 169033767 |
| Molecular Formula | C40H47IrN2O3- |
| Molecular Weight | 799.06 g/mol |
| Exact Mass | 799.34 |
| IUPAC Name | 8-[5-(3-tert-butylphenyl)-2-pyridinyl]-2-(trideuteriomethyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)CC.[2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccc(-c4cccc(C(C)(C)C)c4)cn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C27H23N2O.C13H24O2.Ir/c1-17-11-13-22-21-9-6-10-23(25(21)30-26(22)29-17)24-14-12-19(16-28-24)18-7-5-8-20(15-18)27(2,3)4;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h5-9,11-16H,1-4H3;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-;/i1D3;; |
| InChIKey | VLEMLNHOZBNWKZ-QQTUFXDCSA-N |
| XLogP | 10.98 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.06 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|