C38H37F3IrNO2- — CID 162128015
3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;7-(2H-naphthalen-2-id-1-yl)-6-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 162128015) has the molecular formula C38H37F3IrNO2- and a molecular weight of 788.93 g/mol. Its IUPAC name is 3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;7-(2H-naphthalen-2-id-1-yl)-6-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;7-(2H-naphthalen-2-id-1-yl)-6-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 162128015 |
| Molecular Formula | C38H37F3IrNO2- |
| Molecular Weight | 788.93 g/mol |
| Exact Mass | 789.24 |
| IUPAC Name | 3-hydroxy-3-(4-methylcyclohexyl)-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-one;iridium;7-(2H-naphthalen-2-id-1-yl)-6-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | CC1CCC(C(O)=CC(=O)C2CCC(C(F)(F)F)CC2)CC1.[Ir].[c-]1ccc2ccccc2c1-c1ncc2c3c(cccc13)C=C2 |
| InChI | InChI=1S/C21H12N.C17H25F3O2.Ir/c1-2-8-17-14(5-1)6-3-9-18(17)21-19-10-4-7-15-11-12-16(13-22-21)20(15)19;1-11-2-4-12(5-3-11)15(21)10-16(22)13-6-8-14(9-7-13)17(18,19)20;/h1-8,10-13H;10-14,21H,2-9H2,1H3;/q-1;; |
| InChIKey | ABFYVGPMMNRMEP-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.93 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|