C19H19IrNO-2 — CID 155610243
butan-2-ol;iridium;2-phenylquinoline (PubChem CID 155610243) has the molecular formula C19H19IrNO-2 and a molecular weight of 469.58 g/mol. Its IUPAC name is butan-2-ol;iridium;2-phenylquinoline.
| Compound Name | butan-2-ol;iridium;2-phenylquinoline |
|---|---|
| PubChem CID | 155610243 |
| Molecular Formula | C19H19IrNO-2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | butan-2-ol;iridium;2-phenylquinoline |
| SMILES | [CH2-]CC(C)O.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C4H9O.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-3-4(2)5;/h1-6,8-11H;4-5H,1,3H2,2H3;/q2*-1; |
| InChIKey | SDGGYGCESNDQMP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|