C33H27IrN3-2 — CID 157261228
iridium;2-phenylquinoline;1-phenyl-5-(2,4,6-trimethylphenyl)pyrazole (PubChem CID 157261228) has the molecular formula C33H27IrN3-2 and a molecular weight of 657.82 g/mol. Its IUPAC name is iridium;2-phenylquinoline;1-phenyl-5-(2,4,6-trimethylphenyl)pyrazole.
| Compound Name | iridium;2-phenylquinoline;1-phenyl-5-(2,4,6-trimethylphenyl)pyrazole |
|---|---|
| PubChem CID | 157261228 |
| Molecular Formula | C33H27IrN3-2 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | iridium;2-phenylquinoline;1-phenyl-5-(2,4,6-trimethylphenyl)pyrazole |
| SMILES | Cc1cc(C)c(-c2ccnn2-c2[c-]cccc2)c(C)c1.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H17N2.C15H10N.Ir/c1-13-11-14(2)18(15(3)12-13)17-9-10-19-20(17)16-7-5-4-6-8-16;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;/h4-7,9-12H,1-3H3;1-6,8-11H;/q2*-1; |
| InChIKey | RWUUYDHRZHGGPS-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|