C20H20IrNO2- — CID 146899847
iridium;pent-2-ene-2,4-diol;2-phenylquinoline (PubChem CID 146899847) has the molecular formula C20H20IrNO2- and a molecular weight of 498.60 g/mol. Its IUPAC name is iridium;pent-2-ene-2,4-diol;2-phenylquinoline.
| Compound Name | iridium;pent-2-ene-2,4-diol;2-phenylquinoline |
|---|---|
| PubChem CID | 146899847 |
| Molecular Formula | C20H20IrNO2- |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | iridium;pent-2-ene-2,4-diol;2-phenylquinoline |
| SMILES | CC(O)=CC(C)O.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C5H10O2.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-4(6)3-5(2)7;/h1-6,8-11H;3-4,6-7H,1-2H3;/q-1;; |
| InChIKey | YBQNRSDZVYHNHF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|