C32H25IrN3-2 — CID 140663295
1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium;2-phenylquinoline (PubChem CID 140663295) has the molecular formula C32H25IrN3-2 and a molecular weight of 643.79 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium;2-phenylquinoline.
| Compound Name | 1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium;2-phenylquinoline |
|---|---|
| PubChem CID | 140663295 |
| Molecular Formula | C32H25IrN3-2 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-phenylimidazole;iridium;2-phenylquinoline |
| SMILES | Cc1cccc(C)c1-n1ccnc1-c1[c-]cccc1.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H15N2.C15H10N.Ir/c1-13-7-6-8-14(2)16(13)19-12-11-18-17(19)15-9-4-3-5-10-15;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;/h3-9,11-12H,1-2H3;1-6,8-11H;/q2*-1; |
| InChIKey | BCFGINKIZDOCGR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|