C18H17IrN2- — CID 58750753
1-(2,6-dimethylphenyl)-2-(4-methylbenzene-6-id-1-yl)imidazole;iridium (PubChem CID 58750753) has the molecular formula C18H17IrN2- and a molecular weight of 453.57 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-(4-methylbenzene-6-id-1-yl)imidazole;iridium.
| Compound Name | 1-(2,6-dimethylphenyl)-2-(4-methylbenzene-6-id-1-yl)imidazole;iridium |
|---|---|
| PubChem CID | 58750753 |
| Molecular Formula | C18H17IrN2- |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-(4-methylbenzene-6-id-1-yl)imidazole;iridium |
| SMILES | Cc1c[c-]c(-c2nccn2-c2c(C)cccc2C)cc1.[Ir] |
| InChI | InChI=1S/C18H17N2.Ir/c1-13-7-9-16(10-8-13)18-19-11-12-20(18)17-14(2)5-4-6-15(17)3;/h4-9,11-12H,1-3H3;/q-1; |
| InChIKey | XCVVTTDIFFJDET-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|