C18H16BrIrN2O- — CID 58947306
2-(3-bromo-4-methoxybenzene-6-id-1-yl)-1-(2,6-dimethylphenyl)imidazole;iridium (PubChem CID 58947306) has the molecular formula C18H16BrIrN2O- and a molecular weight of 548.46 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxybenzene-6-id-1-yl)-1-(2,6-dimethylphenyl)imidazole;iridium.
| Compound Name | 2-(3-bromo-4-methoxybenzene-6-id-1-yl)-1-(2,6-dimethylphenyl)imidazole;iridium |
|---|---|
| PubChem CID | 58947306 |
| Molecular Formula | C18H16BrIrN2O- |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | 2-(3-bromo-4-methoxybenzene-6-id-1-yl)-1-(2,6-dimethylphenyl)imidazole;iridium |
| SMILES | COc1c[c-]c(-c2nccn2-c2c(C)cccc2C)cc1Br.[Ir] |
| InChI | InChI=1S/C18H16BrN2O.Ir/c1-12-5-4-6-13(2)17(12)21-10-9-20-18(21)14-7-8-16(22-3)15(19)11-14;/h4-6,8-11H,1-3H3;/q-1; |
| InChIKey | UIYIQVKQVOMAPH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|