C16H17IrN4O- — CID 58947201
iridium;5-[1-(4-methoxy-2,6-dimethylphenyl)imidazol-2-yl]-3-methyl-4H-imidazol-4-ide (PubChem CID 58947201) has the molecular formula C16H17IrN4O- and a molecular weight of 473.56 g/mol. Its IUPAC name is iridium;5-[1-(4-methoxy-2,6-dimethylphenyl)imidazol-2-yl]-3-methyl-4H-imidazol-4-ide.
| Compound Name | iridium;5-[1-(4-methoxy-2,6-dimethylphenyl)imidazol-2-yl]-3-methyl-4H-imidazol-4-ide |
|---|---|
| PubChem CID | 58947201 |
| Molecular Formula | C16H17IrN4O- |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | iridium;5-[1-(4-methoxy-2,6-dimethylphenyl)imidazol-2-yl]-3-methyl-4H-imidazol-4-ide |
| SMILES | COc1cc(C)c(-n2ccnc2-c2[c-]n(C)cn2)c(C)c1.[Ir] |
| InChI | InChI=1S/C16H17N4O.Ir/c1-11-7-13(21-4)8-12(2)15(11)20-6-5-17-16(20)14-9-19(3)10-18-14;/h5-8,10H,1-4H3;/q-1; |
| InChIKey | OWRMPTXRIDUMMY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|