C19H19N2O+ — CID 58113536
1-(4-methoxy-2,6-dimethylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium (PubChem CID 58113536) has the molecular formula C19H19N2O+ and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-(4-methoxy-2,6-dimethylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium.
| Compound Name | 1-(4-methoxy-2,6-dimethylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium |
|---|---|
| PubChem CID | 58113536 |
| Molecular Formula | C19H19N2O+ |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-(4-methoxy-2,6-dimethylphenyl)-5H-imidazo[2,1-a]isoindol-4-ium |
| SMILES | COc1cc(C)c(-n2cc[n+]3c2-c2ccccc2C3)c(C)c1 |
| InChI | InChI=1S/C19H19N2O/c1-13-10-16(22-3)11-14(2)18(13)21-9-8-20-12-15-6-4-5-7-17(15)19(20)21/h4-11H,12H2,1-3H3/q+1 |
| InChIKey | NXQSWONBHYJGGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|