C15H16N4 — CID 140703360
2-(1H-imidazol-2-yl)-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 140703360) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | 2-(1H-imidazol-2-yl)-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 140703360 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2ncc[nH]2)c(C)c1 |
| InChI | InChI=1S/C15H16N4/c1-10-8-11(2)13(12(3)9-10)19-7-6-18-15(19)14-16-4-5-17-14/h4-9H,1-3H3,(H,16,17) |
| InChIKey | VSXKGLMAPHLFRT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |