C20H24N2 — CID 175460608
2-(2,4,6-trimethylphenyl)-1H-imidazole;1,2-xylene (PubChem CID 175460608) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-1H-imidazole;1,2-xylene.
| Compound Name | 2-(2,4,6-trimethylphenyl)-1H-imidazole;1,2-xylene |
|---|---|
| PubChem CID | 175460608 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-1H-imidazole;1,2-xylene |
| SMILES | Cc1cc(C)c(-c2ncc[nH]2)c(C)c1.Cc1ccccc1C |
| InChI | InChI=1S/C12H14N2.C8H10/c1-8-6-9(2)11(10(3)7-8)12-13-4-5-14-12;1-7-5-3-4-6-8(7)2/h4-7H,1-3H3,(H,13,14);3-6H,1-2H3 |
| InChIKey | ABGZBHAQUDOZSX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |