C12H14AgClN2 — CID 174760743
chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole (PubChem CID 174760743) has the molecular formula C12H14AgClN2 and a molecular weight of 329.58 g/mol. Its IUPAC name is chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole.
| Compound Name | chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 174760743 |
| Molecular Formula | C12H14AgClN2 |
| Molecular Weight | 329.58 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole |
| SMILES | Cc1cc(C)c(-c2ncc[nH]2)c(C)c1.Cl[Ag] |
| InChI | InChI=1S/C12H14N2.Ag.ClH/c1-8-6-9(2)11(10(3)7-8)12-13-4-5-14-12;;/h4-7H,1-3H3,(H,13,14);;1H/q;+1;/p-1 |
| InChIKey | NCZZTSCDVIQWOA-UHFFFAOYSA-M |
| XLogP | 3.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |