About chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole
chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole (PubChem CID 174760743) has the molecular formula C12H14AgClN2
and a molecular weight of 329.58 g/mol. Its IUPAC name is chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole.
Molecular Properties
| Compound Name | chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole |
| PubChem CID | 174760743 |
| Molecular Formula | C12H14AgClN2 |
| Molecular Weight | 329.58 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole |
| SMILES | Cc1cc(C)c(-c2ncc[nH]2)c(C)c1.Cl[Ag] |
| InChI | InChI=1S/C12H14N2.Ag.ClH/c1-8-6-9(2)11(10(3)7-8)12-13-4-5-14-12;;/h4-7H,1-3H3,(H,13,14);;1H/q;+1;/p-1 |
| InChIKey | NCZZTSCDVIQWOA-UHFFFAOYSA-M |
| XLogP | 3.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole?
The IUPAC name of chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole (CID 174760743) is chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole.
What is the SMILES notation for chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole?
The canonical SMILES for chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole is Cc1cc(C)c(-c2ncc[nH]2)c(C)c1.Cl[Ag].
What is the InChIKey of chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole?
The InChIKey is NCZZTSCDVIQWOA-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H14N2.Ag.ClH/c1-8-6-9(2)11(10(3)7-8)12-13-4-5-14-12;;/h4-7H,1-3H3,(H,13,14);;1H/q;+1;/p-1.
What are the key properties of chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole?
chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole has a molecular weight of 329.58 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilver;2-(2,4,6-trimethylphenyl)-1H-imidazole is sourced from PubChem (CID 174760743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).