C9H4F4N2 — CID 83402165
2-(2,3,5,6-tetrafluorophenyl)-1H-imidazole (PubChem CID 83402165) has the molecular formula C9H4F4N2 and a molecular weight of 216.14 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluorophenyl)-1H-imidazole.
| Compound Name | 2-(2,3,5,6-tetrafluorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 83402165 |
| Molecular Formula | C9H4F4N2 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-(2,3,5,6-tetrafluorophenyl)-1H-imidazole |
| SMILES | Fc1cc(F)c(F)c(-c2ncc[nH]2)c1F |
| InChI | InChI=1S/C9H4F4N2/c10-4-3-5(11)8(13)6(7(4)12)9-14-1-2-15-9/h1-3H,(H,14,15) |
| InChIKey | LNDQPDKITAEMIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|